C21H27N2O4S+ — CID 126506188
methyl 4-[[2-(1-phenylpyrrolidin-1-ium-1-yl)ethylsulfonylamino]methyl]benzoate (PubChem CID 126506188) has the molecular formula C21H27N2O4S+ and a molecular weight of 403.52 g/mol. Its IUPAC name is methyl 4-[[2-(1-phenylpyrrolidin-1-ium-1-yl)ethylsulfonylamino]methyl]benzoate.
| Compound Name | methyl 4-[[2-(1-phenylpyrrolidin-1-ium-1-yl)ethylsulfonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 126506188 |
| Molecular Formula | C21H27N2O4S+ |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | methyl 4-[[2-(1-phenylpyrrolidin-1-ium-1-yl)ethylsulfonylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNS(=O)(=O)CC[N+]2(c3ccccc3)CCCC2)cc1 |
| InChI | InChI=1S/C21H27N2O4S/c1-27-21(24)19-11-9-18(10-12-19)17-22-28(25,26)16-15-23(13-5-6-14-23)20-7-3-2-4-8-20/h2-4,7-12,22H,5-6,13-17H2,1H3/q+1 |
| InChIKey | DVLQKUKEUGLINL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|