C17H17Cl2NO4S — CID 69182504
methyl 4-[[2-(2,3-dichlorophenyl)ethylsulfonylamino]methyl]benzoate (PubChem CID 69182504) has the molecular formula C17H17Cl2NO4S and a molecular weight of 402.30 g/mol. Its IUPAC name is methyl 4-[[2-(2,3-dichlorophenyl)ethylsulfonylamino]methyl]benzoate.
| Compound Name | methyl 4-[[2-(2,3-dichlorophenyl)ethylsulfonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 69182504 |
| Molecular Formula | C17H17Cl2NO4S |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | methyl 4-[[2-(2,3-dichlorophenyl)ethylsulfonylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNS(=O)(=O)CCc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2NO4S/c1-24-17(21)14-7-5-12(6-8-14)11-20-25(22,23)10-9-13-3-2-4-15(18)16(13)19/h2-8,20H,9-11H2,1H3 |
| InChIKey | LHSJYFFRPNETHP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |