C23H22Cl2N2O3S — CID 69185833
4-[2-(2,3-dichlorophenyl)ethylsulfonylamino]-N-[(1R)-1-phenylethyl]benzamide (PubChem CID 69185833) has the molecular formula C23H22Cl2N2O3S and a molecular weight of 477.41 g/mol. Its IUPAC name is 4-[2-(2,3-dichlorophenyl)ethylsulfonylamino]-N-[(1R)-1-phenylethyl]benzamide.
| Compound Name | 4-[2-(2,3-dichlorophenyl)ethylsulfonylamino]-N-[(1R)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 69185833 |
| Molecular Formula | C23H22Cl2N2O3S |
| Molecular Weight | 477.41 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 4-[2-(2,3-dichlorophenyl)ethylsulfonylamino]-N-[(1R)-1-phenylethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(NS(=O)(=O)CCc2cccc(Cl)c2Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H22Cl2N2O3S/c1-16(17-6-3-2-4-7-17)26-23(28)19-10-12-20(13-11-19)27-31(29,30)15-14-18-8-5-9-21(24)22(18)25/h2-13,16,27H,14-15H2,1H3,(H,26,28)/t16-/m1/s1 |
| InChIKey | QGGHWXKLAYTHAB-MRXNPFEDSA-N |
| XLogP | 5.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.41 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |