C21H26Cl2N4O4S — CID 69181137
4-[2-(2,3-dichlorophenyl)ethylsulfonylamino]-N-[4-(methylcarbamoylamino)butyl]benzamide (PubChem CID 69181137) has the molecular formula C21H26Cl2N4O4S and a molecular weight of 501.44 g/mol. Its IUPAC name is 4-[2-(2,3-dichlorophenyl)ethylsulfonylamino]-N-[4-(methylcarbamoylamino)butyl]benzamide.
| Compound Name | 4-[2-(2,3-dichlorophenyl)ethylsulfonylamino]-N-[4-(methylcarbamoylamino)butyl]benzamide |
|---|---|
| PubChem CID | 69181137 |
| Molecular Formula | C21H26Cl2N4O4S |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | 4-[2-(2,3-dichlorophenyl)ethylsulfonylamino]-N-[4-(methylcarbamoylamino)butyl]benzamide |
| SMILES | CNC(=O)NCCCCNC(=O)c1ccc(NS(=O)(=O)CCc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C21H26Cl2N4O4S/c1-24-21(29)26-13-3-2-12-25-20(28)16-7-9-17(10-8-16)27-32(30,31)14-11-15-5-4-6-18(22)19(15)23/h4-10,27H,2-3,11-14H2,1H3,(H,25,28)(H2,24,26,29) |
| InChIKey | OMQOHELBDFKBEN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|