C22H18Cl2N2O3 — CID 56548908
4-[4-[2-(2,3-dichlorophenyl)ethylcarbamoyl]phenoxy]benzamide (PubChem CID 56548908) has the molecular formula C22H18Cl2N2O3 and a molecular weight of 429.30 g/mol. Its IUPAC name is 4-[4-[2-(2,3-dichlorophenyl)ethylcarbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[2-(2,3-dichlorophenyl)ethylcarbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56548908 |
| Molecular Formula | C22H18Cl2N2O3 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 4-[4-[2-(2,3-dichlorophenyl)ethylcarbamoyl]phenoxy]benzamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(C(=O)NCCc3cccc(Cl)c3Cl)cc2)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O3/c23-19-3-1-2-14(20(19)24)12-13-26-22(28)16-6-10-18(11-7-16)29-17-8-4-15(5-9-17)21(25)27/h1-11H,12-13H2,(H2,25,27)(H,26,28) |
| InChIKey | HNQYBFKTMQHUHL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |