C25H21N3O4 — CID 56548513
4-[4-[2-(2-phenyl-1,3-oxazol-4-yl)ethylcarbamoyl]phenoxy]benzamide (PubChem CID 56548513) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is 4-[4-[2-(2-phenyl-1,3-oxazol-4-yl)ethylcarbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[2-(2-phenyl-1,3-oxazol-4-yl)ethylcarbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56548513 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 4-[4-[2-(2-phenyl-1,3-oxazol-4-yl)ethylcarbamoyl]phenoxy]benzamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(C(=O)NCCc3coc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C25H21N3O4/c26-23(29)17-6-10-21(11-7-17)32-22-12-8-18(9-13-22)24(30)27-15-14-20-16-31-25(28-20)19-4-2-1-3-5-19/h1-13,16H,14-15H2,(H2,26,29)(H,27,30) |
| InChIKey | GFXAEBPXAUBFOG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |