C20H22Cl2N3O4S- — CID 69183545
1-[2-[4-(3-acetamidopropylcarbamoyl)-N-sulfinatoanilino]ethyl]-2,3-dichlorobenzene (PubChem CID 69183545) has the molecular formula C20H22Cl2N3O4S- and a molecular weight of 471.39 g/mol. Its IUPAC name is 1-[2-[4-(3-acetamidopropylcarbamoyl)-N-sulfinatoanilino]ethyl]-2,3-dichlorobenzene.
| Compound Name | 1-[2-[4-(3-acetamidopropylcarbamoyl)-N-sulfinatoanilino]ethyl]-2,3-dichlorobenzene |
|---|---|
| PubChem CID | 69183545 |
| Molecular Formula | C20H22Cl2N3O4S- |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 1-[2-[4-(3-acetamidopropylcarbamoyl)-N-sulfinatoanilino]ethyl]-2,3-dichlorobenzene |
| SMILES | CC(=O)NCCCNC(=O)c1ccc(N(CCc2cccc(Cl)c2Cl)S(=O)[O-])cc1 |
| InChI | InChI=1S/C20H23Cl2N3O4S/c1-14(26)23-11-3-12-24-20(27)16-6-8-17(9-7-16)25(30(28)29)13-10-15-4-2-5-18(21)19(15)22/h2,4-9H,3,10-13H2,1H3,(H,23,26)(H,24,27)(H,28,29)/p-1 |
| InChIKey | OJLBFAGJUAJMJP-UHFFFAOYSA-M |
| XLogP | 3.09 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|