C22H26Cl2N3O3S- — CID 69185366
2-[2-[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinatoamino]benzoyl]amino]ethyl]piperidine (PubChem CID 69185366) has the molecular formula C22H26Cl2N3O3S- and a molecular weight of 483.44 g/mol. Its IUPAC name is 2-[2-[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinatoamino]benzoyl]amino]ethyl]piperidine.
| Compound Name | 2-[2-[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinatoamino]benzoyl]amino]ethyl]piperidine |
|---|---|
| PubChem CID | 69185366 |
| Molecular Formula | C22H26Cl2N3O3S- |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 2-[2-[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinatoamino]benzoyl]amino]ethyl]piperidine |
| SMILES | O=C(NCCC1CCCCN1)c1ccc(N(CCc2cccc(Cl)c2Cl)S(=O)[O-])cc1 |
| InChI | InChI=1S/C22H27Cl2N3O3S/c23-20-6-3-4-16(21(20)24)12-15-27(31(29)30)19-9-7-17(8-10-19)22(28)26-14-11-18-5-1-2-13-25-18/h3-4,6-10,18,25H,1-2,5,11-15H2,(H,26,28)(H,29,30)/p-1 |
| InChIKey | IGYGJFHIZVTMQG-UHFFFAOYSA-M |
| XLogP | 4.10 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|