C21H19ClN3O3S- — CID 69181284
3-[[[4-[2-(2-chlorophenyl)ethyl-sulfinatoamino]benzoyl]amino]methyl]pyridine (PubChem CID 69181284) has the molecular formula C21H19ClN3O3S- and a molecular weight of 428.92 g/mol. Its IUPAC name is 3-[[[4-[2-(2-chlorophenyl)ethyl-sulfinatoamino]benzoyl]amino]methyl]pyridine.
| Compound Name | 3-[[[4-[2-(2-chlorophenyl)ethyl-sulfinatoamino]benzoyl]amino]methyl]pyridine |
|---|---|
| PubChem CID | 69181284 |
| Molecular Formula | C21H19ClN3O3S- |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 3-[[[4-[2-(2-chlorophenyl)ethyl-sulfinatoamino]benzoyl]amino]methyl]pyridine |
| SMILES | O=C(NCc1cccnc1)c1ccc(N(CCc2ccccc2Cl)S(=O)[O-])cc1 |
| InChI | InChI=1S/C21H20ClN3O3S/c22-20-6-2-1-5-17(20)11-13-25(29(27)28)19-9-7-18(8-10-19)21(26)24-15-16-4-3-12-23-14-16/h1-10,12,14H,11,13,15H2,(H,24,26)(H,27,28)/p-1 |
| InChIKey | HBEJCLFBOGLHJI-UHFFFAOYSA-M |
| XLogP | 3.51 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|