C21H20N3O3S- — CID 175218398
3-[[[4-methyl-3-(4-methyl-N-sulfinatoanilino)benzoyl]amino]methyl]pyridine (PubChem CID 175218398) has the molecular formula C21H20N3O3S- and a molecular weight of 394.48 g/mol. Its IUPAC name is 3-[[[4-methyl-3-(4-methyl-N-sulfinatoanilino)benzoyl]amino]methyl]pyridine.
| Compound Name | 3-[[[4-methyl-3-(4-methyl-N-sulfinatoanilino)benzoyl]amino]methyl]pyridine |
|---|---|
| PubChem CID | 175218398 |
| Molecular Formula | C21H20N3O3S- |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 3-[[[4-methyl-3-(4-methyl-N-sulfinatoanilino)benzoyl]amino]methyl]pyridine |
| SMILES | Cc1ccc(N(c2cc(C(=O)NCc3cccnc3)ccc2C)S(=O)[O-])cc1 |
| InChI | InChI=1S/C21H21N3O3S/c1-15-5-9-19(10-6-15)24(28(26)27)20-12-18(8-7-16(20)2)21(25)23-14-17-4-3-11-22-13-17/h3-13H,14H2,1-2H3,(H,23,25)(H,26,27)/p-1 |
| InChIKey | ZKQCQKPTVQWVOS-UHFFFAOYSA-M |
| XLogP | 3.56 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|