C21H17F3N3O3S- — CID 175220185
3-[[[4-methyl-3-[N-sulfinato-4-(trifluoromethyl)anilino]benzoyl]amino]methyl]pyridine (PubChem CID 175220185) has the molecular formula C21H17F3N3O3S- and a molecular weight of 448.45 g/mol. Its IUPAC name is 3-[[[4-methyl-3-[N-sulfinato-4-(trifluoromethyl)anilino]benzoyl]amino]methyl]pyridine.
| Compound Name | 3-[[[4-methyl-3-[N-sulfinato-4-(trifluoromethyl)anilino]benzoyl]amino]methyl]pyridine |
|---|---|
| PubChem CID | 175220185 |
| Molecular Formula | C21H17F3N3O3S- |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 3-[[[4-methyl-3-[N-sulfinato-4-(trifluoromethyl)anilino]benzoyl]amino]methyl]pyridine |
| SMILES | Cc1ccc(C(=O)NCc2cccnc2)cc1N(c1ccc(C(F)(F)F)cc1)S(=O)[O-] |
| InChI | InChI=1S/C21H18F3N3O3S/c1-14-4-5-16(20(28)26-13-15-3-2-10-25-12-15)11-19(14)27(31(29)30)18-8-6-17(7-9-18)21(22,23)24/h2-12H,13H2,1H3,(H,26,28)(H,29,30)/p-1 |
| InChIKey | WMKOPAKQAAIMLD-UHFFFAOYSA-M |
| XLogP | 4.27 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|