C22H22N3O3S- — CID 175220877
3-[[[3-(2,4-dimethyl-N-sulfinatoanilino)-4-methylbenzoyl]amino]methyl]pyridine (PubChem CID 175220877) has the molecular formula C22H22N3O3S- and a molecular weight of 408.50 g/mol. Its IUPAC name is 3-[[[3-(2,4-dimethyl-N-sulfinatoanilino)-4-methylbenzoyl]amino]methyl]pyridine.
| Compound Name | 3-[[[3-(2,4-dimethyl-N-sulfinatoanilino)-4-methylbenzoyl]amino]methyl]pyridine |
|---|---|
| PubChem CID | 175220877 |
| Molecular Formula | C22H22N3O3S- |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 3-[[[3-(2,4-dimethyl-N-sulfinatoanilino)-4-methylbenzoyl]amino]methyl]pyridine |
| SMILES | Cc1ccc(N(c2cc(C(=O)NCc3cccnc3)ccc2C)S(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C22H23N3O3S/c1-15-6-9-20(17(3)11-15)25(29(27)28)21-12-19(8-7-16(21)2)22(26)24-14-18-5-4-10-23-13-18/h4-13H,14H2,1-3H3,(H,24,26)(H,27,28)/p-1 |
| InChIKey | ISAIEYWQJBQBIU-UHFFFAOYSA-M |
| XLogP | 3.87 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|