C19H18FN4O3S- — CID 175038970
4-[[[4-fluoro-3-(4-methyl-N-sulfinatoanilino)benzoyl]amino]methyl]-1-methylpyrazole (PubChem CID 175038970) has the molecular formula C19H18FN4O3S- and a molecular weight of 401.44 g/mol. Its IUPAC name is 4-[[[4-fluoro-3-(4-methyl-N-sulfinatoanilino)benzoyl]amino]methyl]-1-methylpyrazole.
| Compound Name | 4-[[[4-fluoro-3-(4-methyl-N-sulfinatoanilino)benzoyl]amino]methyl]-1-methylpyrazole |
|---|---|
| PubChem CID | 175038970 |
| Molecular Formula | C19H18FN4O3S- |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 4-[[[4-fluoro-3-(4-methyl-N-sulfinatoanilino)benzoyl]amino]methyl]-1-methylpyrazole |
| SMILES | Cc1ccc(N(c2cc(C(=O)NCc3cnn(C)c3)ccc2F)S(=O)[O-])cc1 |
| InChI | InChI=1S/C19H19FN4O3S/c1-13-3-6-16(7-4-13)24(28(26)27)18-9-15(5-8-17(18)20)19(25)21-10-14-11-22-23(2)12-14/h3-9,11-12H,10H2,1-2H3,(H,21,25)(H,26,27)/p-1 |
| InChIKey | CBCWUTKURWBBRS-UHFFFAOYSA-M |
| XLogP | 2.73 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|