C22H24N4O3S — CID 175034510
4-[[[3-[2,3-dihydro-1H-inden-5-yl(sulfino)amino]-4-methylbenzoyl]amino]methyl]-1-methylpyrazole (PubChem CID 175034510) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is 4-[[[3-[2,3-dihydro-1H-inden-5-yl(sulfino)amino]-4-methylbenzoyl]amino]methyl]-1-methylpyrazole.
| Compound Name | 4-[[[3-[2,3-dihydro-1H-inden-5-yl(sulfino)amino]-4-methylbenzoyl]amino]methyl]-1-methylpyrazole |
|---|---|
| PubChem CID | 175034510 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 4-[[[3-[2,3-dihydro-1H-inden-5-yl(sulfino)amino]-4-methylbenzoyl]amino]methyl]-1-methylpyrazole |
| SMILES | Cc1ccc(C(=O)NCc2cnn(C)c2)cc1N(c1ccc2c(c1)CCC2)S(=O)O |
| InChI | InChI=1S/C22H24N4O3S/c1-15-6-7-19(22(27)23-12-16-13-24-25(2)14-16)11-21(15)26(30(28)29)20-9-8-17-4-3-5-18(17)10-20/h6-11,13-14H,3-5,12H2,1-2H3,(H,23,27)(H,28,29) |
| InChIKey | QNNVUOBYWFJMRF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|