C20H19N5O3S — CID 175036213
4-[[[3-(4-cyano-N-sulfinoanilino)-4-methylbenzoyl]amino]methyl]-1-methylpyrazole (PubChem CID 175036213) has the molecular formula C20H19N5O3S and a molecular weight of 409.47 g/mol. Its IUPAC name is 4-[[[3-(4-cyano-N-sulfinoanilino)-4-methylbenzoyl]amino]methyl]-1-methylpyrazole.
| Compound Name | 4-[[[3-(4-cyano-N-sulfinoanilino)-4-methylbenzoyl]amino]methyl]-1-methylpyrazole |
|---|---|
| PubChem CID | 175036213 |
| Molecular Formula | C20H19N5O3S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 4-[[[3-(4-cyano-N-sulfinoanilino)-4-methylbenzoyl]amino]methyl]-1-methylpyrazole |
| SMILES | Cc1ccc(C(=O)NCc2cnn(C)c2)cc1N(c1ccc(C#N)cc1)S(=O)O |
| InChI | InChI=1S/C20H19N5O3S/c1-14-3-6-17(20(26)22-11-16-12-23-24(2)13-16)9-19(14)25(29(27)28)18-7-4-15(10-21)5-8-18/h3-9,12-13H,11H2,1-2H3,(H,22,26)(H,27,28) |
| InChIKey | UMIVXEJQZRMKIW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|