C24H30Cl2N3O3S- — CID 69183487
1-[3-[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinatoamino]benzoyl]amino]propyl]-2-methylpiperidine (PubChem CID 69183487) has the molecular formula C24H30Cl2N3O3S- and a molecular weight of 511.50 g/mol. Its IUPAC name is 1-[3-[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinatoamino]benzoyl]amino]propyl]-2-methylpiperidine.
| Compound Name | 1-[3-[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinatoamino]benzoyl]amino]propyl]-2-methylpiperidine |
|---|---|
| PubChem CID | 69183487 |
| Molecular Formula | C24H30Cl2N3O3S- |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 1-[3-[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinatoamino]benzoyl]amino]propyl]-2-methylpiperidine |
| SMILES | CC1CCCCN1CCCNC(=O)c1ccc(N(CCc2cccc(Cl)c2Cl)S(=O)[O-])cc1 |
| InChI | InChI=1S/C24H31Cl2N3O3S/c1-18-6-2-3-15-28(18)16-5-14-27-24(30)20-9-11-21(12-10-20)29(33(31)32)17-13-19-7-4-8-22(25)23(19)26/h4,7-12,18H,2-3,5-6,13-17H2,1H3,(H,27,30)(H,31,32)/p-1 |
| InChIKey | UIXLDIFXERZTGE-UHFFFAOYSA-M |
| XLogP | 4.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|