C22H24Cl2N4O3S — CID 69492936
1-[3-[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinoamino]benzoyl]amino]propyl]-2-methylimidazole (PubChem CID 69492936) has the molecular formula C22H24Cl2N4O3S and a molecular weight of 495.43 g/mol. Its IUPAC name is 1-[3-[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinoamino]benzoyl]amino]propyl]-2-methylimidazole.
| Compound Name | 1-[3-[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinoamino]benzoyl]amino]propyl]-2-methylimidazole |
|---|---|
| PubChem CID | 69492936 |
| Molecular Formula | C22H24Cl2N4O3S |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | 1-[3-[[4-[2-(2,3-dichlorophenyl)ethyl-sulfinoamino]benzoyl]amino]propyl]-2-methylimidazole |
| SMILES | Cc1nccn1CCCNC(=O)c1ccc(N(CCc2cccc(Cl)c2Cl)S(=O)O)cc1 |
| InChI | InChI=1S/C22H24Cl2N4O3S/c1-16-25-12-15-27(16)13-3-11-26-22(29)18-6-8-19(9-7-18)28(32(30)31)14-10-17-4-2-5-20(23)21(17)24/h2,4-9,12,15H,3,10-11,13-14H2,1H3,(H,26,29)(H,30,31) |
| InChIKey | BULSVVBHQXJMLB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|