C16H14Cl2NO4S- — CID 69185403
1,2-dichloro-3-[2-(2-methoxycarbonyl-N-sulfinatoanilino)ethyl]benzene (PubChem CID 69185403) has the molecular formula C16H14Cl2NO4S- and a molecular weight of 387.26 g/mol. Its IUPAC name is 1,2-dichloro-3-[2-(2-methoxycarbonyl-N-sulfinatoanilino)ethyl]benzene.
| Compound Name | 1,2-dichloro-3-[2-(2-methoxycarbonyl-N-sulfinatoanilino)ethyl]benzene |
|---|---|
| PubChem CID | 69185403 |
| Molecular Formula | C16H14Cl2NO4S- |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | 1,2-dichloro-3-[2-(2-methoxycarbonyl-N-sulfinatoanilino)ethyl]benzene |
| SMILES | COC(=O)c1ccccc1N(CCc1cccc(Cl)c1Cl)S(=O)[O-] |
| InChI | InChI=1S/C16H15Cl2NO4S/c1-23-16(20)12-6-2-3-8-14(12)19(24(21)22)10-9-11-5-4-7-13(17)15(11)18/h2-8H,9-10H2,1H3,(H,21,22)/p-1 |
| InChIKey | VYHHVNDFABLDSK-UHFFFAOYSA-M |
| XLogP | 3.62 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|