C21H26ClFN3O5S+ — CID 126506380
methyl 6-[[3-[4-(3-chloro-4-fluorophenyl)morpholin-4-ium-4-yl]propylsulfonylamino]methyl]pyridine-3-carboxylate (PubChem CID 126506380) has the molecular formula C21H26ClFN3O5S+ and a molecular weight of 486.97 g/mol. Its IUPAC name is methyl 6-[[3-[4-(3-chloro-4-fluorophenyl)morpholin-4-ium-4-yl]propylsulfonylamino]methyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[[3-[4-(3-chloro-4-fluorophenyl)morpholin-4-ium-4-yl]propylsulfonylamino]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 126506380 |
| Molecular Formula | C21H26ClFN3O5S+ |
| Molecular Weight | 486.97 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | methyl 6-[[3-[4-(3-chloro-4-fluorophenyl)morpholin-4-ium-4-yl]propylsulfonylamino]methyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(CNS(=O)(=O)CCC[N+]2(c3ccc(F)c(Cl)c3)CCOCC2)nc1 |
| InChI | InChI=1S/C21H26ClFN3O5S/c1-30-21(27)16-3-4-17(24-14-16)15-25-32(28,29)12-2-7-26(8-10-31-11-9-26)18-5-6-20(23)19(22)13-18/h3-6,13-14,25H,2,7-12,15H2,1H3/q+1 |
| InChIKey | MRMLVFUXVLOPBA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.97 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|