C21H25ClFN3O5S — CID 175127012
4-[1-(3-chloro-4-fluorophenyl)-3-[(5-methoxycarbonyl-2-pyridinyl)methyl-sulfinoamino]propyl]morpholine (PubChem CID 175127012) has the molecular formula C21H25ClFN3O5S and a molecular weight of 485.97 g/mol. Its IUPAC name is 4-[1-(3-chloro-4-fluorophenyl)-3-[(5-methoxycarbonyl-2-pyridinyl)methyl-sulfinoamino]propyl]morpholine.
| Compound Name | 4-[1-(3-chloro-4-fluorophenyl)-3-[(5-methoxycarbonyl-2-pyridinyl)methyl-sulfinoamino]propyl]morpholine |
|---|---|
| PubChem CID | 175127012 |
| Molecular Formula | C21H25ClFN3O5S |
| Molecular Weight | 485.97 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 4-[1-(3-chloro-4-fluorophenyl)-3-[(5-methoxycarbonyl-2-pyridinyl)methyl-sulfinoamino]propyl]morpholine |
| SMILES | COC(=O)c1ccc(CN(CCC(c2ccc(F)c(Cl)c2)N2CCOCC2)S(=O)O)nc1 |
| InChI | InChI=1S/C21H25ClFN3O5S/c1-30-21(27)16-2-4-17(24-13-16)14-26(32(28)29)7-6-20(25-8-10-31-11-9-25)15-3-5-19(23)18(22)12-15/h2-5,12-13,20H,6-11,14H2,1H3,(H,28,29) |
| InChIKey | FXNPNCCVJGHDQT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.97 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|