C19H22ClN3O5 — CID 162171346
methyl 6-(chloromethyl)pyridine-3-carboxylate;6-(morpholin-4-ylmethyl)pyridine-3-carboxylic acid (PubChem CID 162171346) has the molecular formula C19H22ClN3O5 and a molecular weight of 407.85 g/mol. Its IUPAC name is methyl 6-(chloromethyl)pyridine-3-carboxylate;6-(morpholin-4-ylmethyl)pyridine-3-carboxylic acid.
| Compound Name | methyl 6-(chloromethyl)pyridine-3-carboxylate;6-(morpholin-4-ylmethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 162171346 |
| Molecular Formula | C19H22ClN3O5 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | methyl 6-(chloromethyl)pyridine-3-carboxylate;6-(morpholin-4-ylmethyl)pyridine-3-carboxylic acid |
| SMILES | COC(=O)c1ccc(CCl)nc1.O=C(O)c1ccc(CN2CCOCC2)nc1 |
| InChI | InChI=1S/C11H14N2O3.C8H8ClNO2/c14-11(15)9-1-2-10(12-7-9)8-13-3-5-16-6-4-13;1-12-8(11)6-2-3-7(4-9)10-5-6/h1-2,7H,3-6,8H2,(H,14,15);2-3,5H,4H2,1H3 |
| InChIKey | ZNVIRAXXRHYLIU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|