C27H27N5O2 — CID 59240637
methyl 6-[[4-(4-benzylphthalazin-1-yl)piperazin-1-yl]methyl]pyridine-3-carboxylate (PubChem CID 59240637) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is methyl 6-[[4-(4-benzylphthalazin-1-yl)piperazin-1-yl]methyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[[4-(4-benzylphthalazin-1-yl)piperazin-1-yl]methyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 59240637 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | methyl 6-[[4-(4-benzylphthalazin-1-yl)piperazin-1-yl]methyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(CN2CCN(c3nnc(Cc4ccccc4)c4ccccc34)CC2)nc1 |
| InChI | InChI=1S/C27H27N5O2/c1-34-27(33)21-11-12-22(28-18-21)19-31-13-15-32(16-14-31)26-24-10-6-5-9-23(24)25(29-30-26)17-20-7-3-2-4-8-20/h2-12,18H,13-17,19H2,1H3 |
| InChIKey | XOTJVFSPJKFXSS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |