C28H25N5O2 — CID 135268219
methyl 6-[(3S)-4-(4-benzylphthalazin-1-yl)-3-ethynylpiperazin-1-yl]pyridine-3-carboxylate (PubChem CID 135268219) has the molecular formula C28H25N5O2 and a molecular weight of 463.54 g/mol. Its IUPAC name is methyl 6-[(3S)-4-(4-benzylphthalazin-1-yl)-3-ethynylpiperazin-1-yl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[(3S)-4-(4-benzylphthalazin-1-yl)-3-ethynylpiperazin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 135268219 |
| Molecular Formula | C28H25N5O2 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | methyl 6-[(3S)-4-(4-benzylphthalazin-1-yl)-3-ethynylpiperazin-1-yl]pyridine-3-carboxylate |
| SMILES | C#C[C@H]1CN(c2ccc(C(=O)OC)cn2)CCN1c1nnc(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C28H25N5O2/c1-3-22-19-32(26-14-13-21(18-29-26)28(34)35-2)15-16-33(22)27-24-12-8-7-11-23(24)25(30-31-27)17-20-9-5-4-6-10-20/h1,4-14,18,22H,15-17,19H2,2H3/t22-/m0/s1 |
| InChIKey | IXFLSZLWTKJCLR-QFIPXVFZSA-N |
| XLogP | 3.73 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|