C26H28N5OP — CID 59240660
1-benzyl-4-[4-(5-dimethylphosphoryl-2-pyridinyl)piperazin-1-yl]phthalazine (PubChem CID 59240660) has the molecular formula C26H28N5OP and a molecular weight of 457.52 g/mol. Its IUPAC name is 1-benzyl-4-[4-(5-dimethylphosphoryl-2-pyridinyl)piperazin-1-yl]phthalazine.
| Compound Name | 1-benzyl-4-[4-(5-dimethylphosphoryl-2-pyridinyl)piperazin-1-yl]phthalazine |
|---|---|
| PubChem CID | 59240660 |
| Molecular Formula | C26H28N5OP |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 1-benzyl-4-[4-(5-dimethylphosphoryl-2-pyridinyl)piperazin-1-yl]phthalazine |
| SMILES | CP(C)(=O)c1ccc(N2CCN(c3nnc(Cc4ccccc4)c4ccccc34)CC2)nc1 |
| InChI | InChI=1S/C26H28N5OP/c1-33(2,32)21-12-13-25(27-19-21)30-14-16-31(17-15-30)26-23-11-7-6-10-22(23)24(28-29-26)18-20-8-4-3-5-9-20/h3-13,19H,14-18H2,1-2H3 |
| InChIKey | KVVFUQUXCXRWLQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|