C26H28N5P — CID 135268406
[6-[4-(4-benzylphthalazin-1-yl)piperazin-1-yl]-3-pyridinyl]-dimethylphosphane (PubChem CID 135268406) has the molecular formula C26H28N5P and a molecular weight of 441.52 g/mol. Its IUPAC name is [6-[4-(4-benzylphthalazin-1-yl)piperazin-1-yl]-3-pyridinyl]-dimethylphosphane.
| Compound Name | [6-[4-(4-benzylphthalazin-1-yl)piperazin-1-yl]-3-pyridinyl]-dimethylphosphane |
|---|---|
| PubChem CID | 135268406 |
| Molecular Formula | C26H28N5P |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | [6-[4-(4-benzylphthalazin-1-yl)piperazin-1-yl]-3-pyridinyl]-dimethylphosphane |
| SMILES | CP(C)c1ccc(N2CCN(c3nnc(Cc4ccccc4)c4ccccc34)CC2)nc1 |
| InChI | InChI=1S/C26H28N5P/c1-32(2)21-12-13-25(27-19-21)30-14-16-31(17-15-30)26-23-11-7-6-10-22(23)24(28-29-26)18-20-8-4-3-5-9-20/h3-13,19H,14-18H2,1-2H3 |
| InChIKey | WMBAOOFSJASOFV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|