C25H21BrN6 — CID 25065897
6-[4-[4-[(4-bromophenyl)methyl]phthalazin-1-yl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 25065897) has the molecular formula C25H21BrN6 and a molecular weight of 485.39 g/mol. Its IUPAC name is 6-[4-[4-[(4-bromophenyl)methyl]phthalazin-1-yl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[4-[(4-bromophenyl)methyl]phthalazin-1-yl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 25065897 |
| Molecular Formula | C25H21BrN6 |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 6-[4-[4-[(4-bromophenyl)methyl]phthalazin-1-yl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCN(c3nnc(Cc4ccc(Br)cc4)c4ccccc34)CC2)nc1 |
| InChI | InChI=1S/C25H21BrN6/c26-20-8-5-18(6-9-20)15-23-21-3-1-2-4-22(21)25(30-29-23)32-13-11-31(12-14-32)24-10-7-19(16-27)17-28-24/h1-10,17H,11-15H2 |
| InChIKey | MIQTYOIOSUYCAN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 68.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |