C28H28N6O3 — CID 25065892
methyl 2-[[6-[4-(4-benzylphthalazin-1-yl)piperazin-1-yl]pyridine-3-carbonyl]amino]acetate (PubChem CID 25065892) has the molecular formula C28H28N6O3 and a molecular weight of 496.57 g/mol. Its IUPAC name is methyl 2-[[6-[4-(4-benzylphthalazin-1-yl)piperazin-1-yl]pyridine-3-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[6-[4-(4-benzylphthalazin-1-yl)piperazin-1-yl]pyridine-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 25065892 |
| Molecular Formula | C28H28N6O3 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | methyl 2-[[6-[4-(4-benzylphthalazin-1-yl)piperazin-1-yl]pyridine-3-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(N2CCN(c3nnc(Cc4ccccc4)c4ccccc34)CC2)nc1 |
| InChI | InChI=1S/C28H28N6O3/c1-37-26(35)19-30-28(36)21-11-12-25(29-18-21)33-13-15-34(16-14-33)27-23-10-6-5-9-22(23)24(31-32-27)17-20-7-3-2-4-8-20/h2-12,18H,13-17,19H2,1H3,(H,30,36) |
| InChIKey | VWUXQKMNPHDUCU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |