C27H30N6OS — CID 135268454
1-benzyl-4-[4-[5-(1-methylsulfanyloxypropan-2-yl)pyrazin-2-yl]piperazin-1-yl]phthalazine (PubChem CID 135268454) has the molecular formula C27H30N6OS and a molecular weight of 486.65 g/mol. Its IUPAC name is 1-benzyl-4-[4-[5-(1-methylsulfanyloxypropan-2-yl)pyrazin-2-yl]piperazin-1-yl]phthalazine.
| Compound Name | 1-benzyl-4-[4-[5-(1-methylsulfanyloxypropan-2-yl)pyrazin-2-yl]piperazin-1-yl]phthalazine |
|---|---|
| PubChem CID | 135268454 |
| Molecular Formula | C27H30N6OS |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 1-benzyl-4-[4-[5-(1-methylsulfanyloxypropan-2-yl)pyrazin-2-yl]piperazin-1-yl]phthalazine |
| SMILES | CSOCC(C)c1cnc(N2CCN(c3nnc(Cc4ccccc4)c4ccccc34)CC2)cn1 |
| InChI | InChI=1S/C27H30N6OS/c1-20(19-34-35-2)25-17-29-26(18-28-25)32-12-14-33(15-13-32)27-23-11-7-6-10-22(23)24(30-31-27)16-21-8-4-3-5-9-21/h3-11,17-18,20H,12-16,19H2,1-2H3 |
| InChIKey | CSHXLBRLVGZQFV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 67.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|