C15H20N2O4 — CID 11266319
methyl 4-[6-(morpholin-4-ylmethyl)-3-pyridinyl]-4-oxobutanoate (PubChem CID 11266319) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is methyl 4-[6-(morpholin-4-ylmethyl)-3-pyridinyl]-4-oxobutanoate.
| Compound Name | methyl 4-[6-(morpholin-4-ylmethyl)-3-pyridinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 11266319 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | methyl 4-[6-(morpholin-4-ylmethyl)-3-pyridinyl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)c1ccc(CN2CCOCC2)nc1 |
| InChI | InChI=1S/C15H20N2O4/c1-20-15(19)5-4-14(18)12-2-3-13(16-10-12)11-17-6-8-21-9-7-17/h2-3,10H,4-9,11H2,1H3 |
| InChIKey | OZGGKYAKVODRLD-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |