C16H17ClN6 — CID 67314434
2-chloro-N-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methyl]aniline (PubChem CID 67314434) has the molecular formula C16H17ClN6 and a molecular weight of 328.81 g/mol. Its IUPAC name is 2-chloro-N-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methyl]aniline.
| Compound Name | 2-chloro-N-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methyl]aniline |
|---|---|
| PubChem CID | 67314434 |
| Molecular Formula | C16H17ClN6 |
| Molecular Weight | 328.81 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-chloro-N-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methyl]aniline |
| SMILES | Clc1ccccc1NCC1CCCN1c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C16H17ClN6/c17-12-5-1-2-6-13(12)18-8-11-4-3-7-23(11)16-14-15(20-9-19-14)21-10-22-16/h1-2,5-6,9-11,18H,3-4,7-8H2,(H,19,20,21,22) |
| InChIKey | VIXVAVZYYOCQFY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.81 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |