C18H18N6 — CID 167893037
4-[[1-(7H-purin-6-yl)piperidin-2-yl]methyl]benzonitrile (PubChem CID 167893037) has the molecular formula C18H18N6 and a molecular weight of 318.38 g/mol. Its IUPAC name is 4-[[1-(7H-purin-6-yl)piperidin-2-yl]methyl]benzonitrile.
| Compound Name | 4-[[1-(7H-purin-6-yl)piperidin-2-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 167893037 |
| Molecular Formula | C18H18N6 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 4-[[1-(7H-purin-6-yl)piperidin-2-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CC2CCCCN2c2ncnc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C18H18N6/c19-10-14-6-4-13(5-7-14)9-15-3-1-2-8-24(15)18-16-17(21-11-20-16)22-12-23-18/h4-7,11-12,15H,1-3,8-9H2,(H,20,21,22,23) |
| InChIKey | UFHPLVGCQAFZKB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |