C18H19N7 — CID 108774131
6-[4-(6-methyl-1H-benzimidazol-2-yl)piperidin-1-yl]-7H-purine (PubChem CID 108774131) has the molecular formula C18H19N7 and a molecular weight of 333.40 g/mol. Its IUPAC name is 6-[4-(6-methyl-1H-benzimidazol-2-yl)piperidin-1-yl]-7H-purine.
| Compound Name | 6-[4-(6-methyl-1H-benzimidazol-2-yl)piperidin-1-yl]-7H-purine |
|---|---|
| PubChem CID | 108774131 |
| Molecular Formula | C18H19N7 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 6-[4-(6-methyl-1H-benzimidazol-2-yl)piperidin-1-yl]-7H-purine |
| SMILES | Cc1ccc2nc(C3CCN(c4ncnc5nc[nH]c45)CC3)[nH]c2c1 |
| InChI | InChI=1S/C18H19N7/c1-11-2-3-13-14(8-11)24-16(23-13)12-4-6-25(7-5-12)18-15-17(20-9-19-15)21-10-22-18/h2-3,8-10,12H,4-7H2,1H3,(H,23,24)(H,19,20,21,22) |
| InChIKey | PUFMCYKWIUYLPK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |