C18H26N2 — CID 63399500
2-(4-tert-butylcyclohexyl)-6-methyl-1H-benzimidazole (PubChem CID 63399500) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-(4-tert-butylcyclohexyl)-6-methyl-1H-benzimidazole.
| Compound Name | 2-(4-tert-butylcyclohexyl)-6-methyl-1H-benzimidazole |
|---|---|
| PubChem CID | 63399500 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 2-(4-tert-butylcyclohexyl)-6-methyl-1H-benzimidazole |
| SMILES | Cc1ccc2nc(C3CCC(C(C)(C)C)CC3)[nH]c2c1 |
| InChI | InChI=1S/C18H26N2/c1-12-5-10-15-16(11-12)20-17(19-15)13-6-8-14(9-7-13)18(2,3)4/h5,10-11,13-14H,6-9H2,1-4H3,(H,19,20) |
| InChIKey | YPHHJSRSLLKTIT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |