C13H12N2 — CID 162444244
2-cyclopenta-2,4-dien-1-yl-6-methyl-1H-benzimidazole (PubChem CID 162444244) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-cyclopenta-2,4-dien-1-yl-6-methyl-1H-benzimidazole.
| Compound Name | 2-cyclopenta-2,4-dien-1-yl-6-methyl-1H-benzimidazole |
|---|---|
| PubChem CID | 162444244 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 2-cyclopenta-2,4-dien-1-yl-6-methyl-1H-benzimidazole |
| SMILES | Cc1ccc2nc(C3C=CC=C3)[nH]c2c1 |
| InChI | InChI=1S/C13H12N2/c1-9-6-7-11-12(8-9)15-13(14-11)10-4-2-3-5-10/h2-8,10H,1H3,(H,14,15) |
| InChIKey | OKATZMPQGNNVCW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |