C20H31N7O5 — CID 172910809
(3aR,5R,6R,7aS)-6-(4-methylpiperazin-1-yl)-2-(7H-purin-6-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol;formic acid (PubChem CID 172910809) has the molecular formula C20H31N7O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-6-(4-methylpiperazin-1-yl)-2-(7H-purin-6-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol;formic acid.
| Compound Name | (3aR,5R,6R,7aS)-6-(4-methylpiperazin-1-yl)-2-(7H-purin-6-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol;formic acid |
|---|---|
| PubChem CID | 172910809 |
| Molecular Formula | C20H31N7O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | (3aR,5R,6R,7aS)-6-(4-methylpiperazin-1-yl)-2-(7H-purin-6-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol;formic acid |
| SMILES | CN1CCN([C@@H]2C[C@@H]3CN(c4ncnc5nc[nH]c45)C[C@@H]3C[C@H]2O)CC1.O=CO.O=CO |
| InChI | InChI=1S/C18H27N7O.2CH2O2/c1-23-2-4-24(5-3-23)14-6-12-8-25(9-13(12)7-15(14)26)18-16-17(20-10-19-16)21-11-22-18;2*2-1-3/h10-15,26H,2-9H2,1H3,(H,19,20,21,22);2*1H,(H,2,3)/t12-,13+,14-,15-;;/m1../s1 |
| InChIKey | IZOGOIPEVJUNPW-KXWVDFCNSA-N |
| XLogP | -0.42 |
| TPSA | 159.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|