C14H20N6O2 — CID 133380916
tert-butyl N-[(3S)-1-(7H-purin-6-yl)pyrrolidin-3-yl]carbamate (PubChem CID 133380916) has the molecular formula C14H20N6O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-(7H-purin-6-yl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-(7H-purin-6-yl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 133380916 |
| Molecular Formula | C14H20N6O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | tert-butyl N-[(3S)-1-(7H-purin-6-yl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCN(c2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C14H20N6O2/c1-14(2,3)22-13(21)19-9-4-5-20(6-9)12-10-11(16-7-15-10)17-8-18-12/h7-9H,4-6H2,1-3H3,(H,19,21)(H,15,16,17,18)/t9-/m0/s1 |
| InChIKey | CCRGCAZURGRNRG-VIFPVBQESA-N |
| XLogP | 1.46 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |