C13H10BrF3N2O — CID 168505670
2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-5-(trifluoromethyl)benzonitrile (PubChem CID 168505670) has the molecular formula C13H10BrF3N2O and a molecular weight of 347.13 g/mol. Its IUPAC name is 2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 168505670 |
| Molecular Formula | C13H10BrF3N2O |
| Molecular Weight | 347.13 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-5-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)ccc1N1CC(CBr)CC1=O |
| InChI | InChI=1S/C13H10BrF3N2O/c14-5-8-3-12(20)19(7-8)11-2-1-10(13(15,16)17)4-9(11)6-18/h1-2,4,8H,3,5,7H2 |
| InChIKey | OYKNHQPHCUNKBS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.13 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|