C13H7F3N2O2 — CID 115911319
2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-5-(trifluoromethyl)benzonitrile (PubChem CID 115911319) has the molecular formula C13H7F3N2O2 and a molecular weight of 280.21 g/mol. Its IUPAC name is 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 115911319 |
| Molecular Formula | C13H7F3N2O2 |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-(2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)-5-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)ccc1N1C(=O)C2CC2C1=O |
| InChI | InChI=1S/C13H7F3N2O2/c14-13(15,16)7-1-2-10(6(3-7)5-17)18-11(19)8-4-9(8)12(18)20/h1-3,8-9H,4H2 |
| InChIKey | HVCJHEOEIUJIDI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|