C12H9ClF3NO2 — CID 79515454
1-[2-chloro-4-(trifluoromethyl)phenyl]piperidine-2,4-dione (PubChem CID 79515454) has the molecular formula C12H9ClF3NO2 and a molecular weight of 291.66 g/mol. Its IUPAC name is 1-[2-chloro-4-(trifluoromethyl)phenyl]piperidine-2,4-dione.
| Compound Name | 1-[2-chloro-4-(trifluoromethyl)phenyl]piperidine-2,4-dione |
|---|---|
| PubChem CID | 79515454 |
| Molecular Formula | C12H9ClF3NO2 |
| Molecular Weight | 291.66 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 1-[2-chloro-4-(trifluoromethyl)phenyl]piperidine-2,4-dione |
| SMILES | O=C1CCN(c2ccc(C(F)(F)F)cc2Cl)C(=O)C1 |
| InChI | InChI=1S/C12H9ClF3NO2/c13-9-5-7(12(14,15)16)1-2-10(9)17-4-3-8(18)6-11(17)19/h1-2,5H,3-4,6H2 |
| InChIKey | DYAQLZQUWWGXAX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.66 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|