C12H14ClF3N2O2S — CID 90840814
1-[2-chloro-4-(trifluoromethyl)phenyl]piperidine-4-sulfonamide (PubChem CID 90840814) has the molecular formula C12H14ClF3N2O2S and a molecular weight of 342.77 g/mol. Its IUPAC name is 1-[2-chloro-4-(trifluoromethyl)phenyl]piperidine-4-sulfonamide.
| Compound Name | 1-[2-chloro-4-(trifluoromethyl)phenyl]piperidine-4-sulfonamide |
|---|---|
| PubChem CID | 90840814 |
| Molecular Formula | C12H14ClF3N2O2S |
| Molecular Weight | 342.77 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 1-[2-chloro-4-(trifluoromethyl)phenyl]piperidine-4-sulfonamide |
| SMILES | NS(=O)(=O)C1CCN(c2ccc(C(F)(F)F)cc2Cl)CC1 |
| InChI | InChI=1S/C12H14ClF3N2O2S/c13-10-7-8(12(14,15)16)1-2-11(10)18-5-3-9(4-6-18)21(17,19)20/h1-2,7,9H,3-6H2,(H2,17,19,20) |
| InChIKey | AFVUOSDNXTXNIP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.77 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |