C19H25FN2O3 — CID 99836421
methyl 4-[[(3R)-1-(2-fluorophenyl)-2-oxopiperidin-3-yl]amino]cyclohexane-1-carboxylate (PubChem CID 99836421) has the molecular formula C19H25FN2O3 and a molecular weight of 348.42 g/mol. Its IUPAC name is methyl 4-[[(3R)-1-(2-fluorophenyl)-2-oxopiperidin-3-yl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[(3R)-1-(2-fluorophenyl)-2-oxopiperidin-3-yl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 99836421 |
| Molecular Formula | C19H25FN2O3 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | methyl 4-[[(3R)-1-(2-fluorophenyl)-2-oxopiperidin-3-yl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(N[C@@H]2CCCN(c3ccccc3F)C2=O)CC1 |
| InChI | InChI=1S/C19H25FN2O3/c1-25-19(24)13-8-10-14(11-9-13)21-16-6-4-12-22(18(16)23)17-7-3-2-5-15(17)20/h2-3,5,7,13-14,16,21H,4,6,8-12H2,1H3/t13?,14?,16-/m1/s1 |
| InChIKey | BULWSZYJWYPYPC-ZBCRRDGASA-N |
| XLogP | 2.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |