C18H16F2N2O3 — CID 99718154
2-fluoro-N-[(3S)-1-(2-fluorophenyl)-2-oxopiperidin-3-yl]-4-hydroxybenzamide (PubChem CID 99718154) has the molecular formula C18H16F2N2O3 and a molecular weight of 346.33 g/mol. Its IUPAC name is 2-fluoro-N-[(3S)-1-(2-fluorophenyl)-2-oxopiperidin-3-yl]-4-hydroxybenzamide.
| Compound Name | 2-fluoro-N-[(3S)-1-(2-fluorophenyl)-2-oxopiperidin-3-yl]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 99718154 |
| Molecular Formula | C18H16F2N2O3 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 2-fluoro-N-[(3S)-1-(2-fluorophenyl)-2-oxopiperidin-3-yl]-4-hydroxybenzamide |
| SMILES | O=C(N[C@H]1CCCN(c2ccccc2F)C1=O)c1ccc(O)cc1F |
| InChI | InChI=1S/C18H16F2N2O3/c19-13-4-1-2-6-16(13)22-9-3-5-15(18(22)25)21-17(24)12-8-7-11(23)10-14(12)20/h1-2,4,6-8,10,15,23H,3,5,9H2,(H,21,24)/t15-/m0/s1 |
| InChIKey | PJLMSQCHLVZHGP-HNNXBMFYSA-N |
| XLogP | 2.60 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |