C16H19FN2O4 — CID 124589266
methyl 4-[[(3R)-1-(2-fluorophenyl)-2-oxopiperidin-3-yl]amino]-4-oxobutanoate (PubChem CID 124589266) has the molecular formula C16H19FN2O4 and a molecular weight of 322.34 g/mol. Its IUPAC name is methyl 4-[[(3R)-1-(2-fluorophenyl)-2-oxopiperidin-3-yl]amino]-4-oxobutanoate.
| Compound Name | methyl 4-[[(3R)-1-(2-fluorophenyl)-2-oxopiperidin-3-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 124589266 |
| Molecular Formula | C16H19FN2O4 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | methyl 4-[[(3R)-1-(2-fluorophenyl)-2-oxopiperidin-3-yl]amino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N[C@@H]1CCCN(c2ccccc2F)C1=O |
| InChI | InChI=1S/C16H19FN2O4/c1-23-15(21)9-8-14(20)18-12-6-4-10-19(16(12)22)13-7-3-2-5-11(13)17/h2-3,5,7,12H,4,6,8-10H2,1H3,(H,18,20)/t12-/m1/s1 |
| InChIKey | PDCPGSXAXASIJX-GFCCVEGCSA-N |
| XLogP | 1.39 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |