C16H18FNO4 — CID 112535880
methyl 1-[3-(4-fluorophenyl)propanoyl]-3-oxopiperidine-4-carboxylate (PubChem CID 112535880) has the molecular formula C16H18FNO4 and a molecular weight of 307.32 g/mol. Its IUPAC name is methyl 1-[3-(4-fluorophenyl)propanoyl]-3-oxopiperidine-4-carboxylate.
| Compound Name | methyl 1-[3-(4-fluorophenyl)propanoyl]-3-oxopiperidine-4-carboxylate |
|---|---|
| PubChem CID | 112535880 |
| Molecular Formula | C16H18FNO4 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | methyl 1-[3-(4-fluorophenyl)propanoyl]-3-oxopiperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)CCc2ccc(F)cc2)CC1=O |
| InChI | InChI=1S/C16H18FNO4/c1-22-16(21)13-8-9-18(10-14(13)19)15(20)7-4-11-2-5-12(17)6-3-11/h2-3,5-6,13H,4,7-10H2,1H3 |
| InChIKey | JYJOWVICYGHVER-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|