C18H15F3N2O2 — CID 93321851
(3R)-1-(2,4-difluorophenyl)-4-(3-fluorobenzoyl)-3-methylpiperazin-2-one (PubChem CID 93321851) has the molecular formula C18H15F3N2O2 and a molecular weight of 348.32 g/mol. Its IUPAC name is (3R)-1-(2,4-difluorophenyl)-4-(3-fluorobenzoyl)-3-methylpiperazin-2-one.
| Compound Name | (3R)-1-(2,4-difluorophenyl)-4-(3-fluorobenzoyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 93321851 |
| Molecular Formula | C18H15F3N2O2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (3R)-1-(2,4-difluorophenyl)-4-(3-fluorobenzoyl)-3-methylpiperazin-2-one |
| SMILES | C[C@@H]1C(=O)N(c2ccc(F)cc2F)CCN1C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C18H15F3N2O2/c1-11-17(24)23(16-6-5-14(20)10-15(16)21)8-7-22(11)18(25)12-3-2-4-13(19)9-12/h2-6,9-11H,7-8H2,1H3/t11-/m1/s1 |
| InChIKey | ZJVDPOFHLXUGHZ-LLVKDONJSA-N |
| XLogP | 2.98 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |