C20H21FN2O2 — CID 24716392
1-(2,4-dimethylphenyl)-4-(3-fluorobenzoyl)-3-methylpiperazin-2-one (PubChem CID 24716392) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-4-(3-fluorobenzoyl)-3-methylpiperazin-2-one.
| Compound Name | 1-(2,4-dimethylphenyl)-4-(3-fluorobenzoyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 24716392 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-4-(3-fluorobenzoyl)-3-methylpiperazin-2-one |
| SMILES | Cc1ccc(N2CCN(C(=O)c3cccc(F)c3)C(C)C2=O)c(C)c1 |
| InChI | InChI=1S/C20H21FN2O2/c1-13-7-8-18(14(2)11-13)23-10-9-22(15(3)19(23)24)20(25)16-5-4-6-17(21)12-16/h4-8,11-12,15H,9-10H2,1-3H3 |
| InChIKey | JOLVZYHZWMOJCZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |