C25H24N2O2 — CID 93323612
(3R)-3-methyl-4-(3-methylbenzoyl)-1-(2-phenylphenyl)piperazin-2-one (PubChem CID 93323612) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is (3R)-3-methyl-4-(3-methylbenzoyl)-1-(2-phenylphenyl)piperazin-2-one.
| Compound Name | (3R)-3-methyl-4-(3-methylbenzoyl)-1-(2-phenylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 93323612 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | (3R)-3-methyl-4-(3-methylbenzoyl)-1-(2-phenylphenyl)piperazin-2-one |
| SMILES | Cc1cccc(C(=O)N2CCN(c3ccccc3-c3ccccc3)C(=O)[C@H]2C)c1 |
| InChI | InChI=1S/C25H24N2O2/c1-18-9-8-12-21(17-18)25(29)26-15-16-27(24(28)19(26)2)23-14-7-6-13-22(23)20-10-4-3-5-11-20/h3-14,17,19H,15-16H2,1-2H3/t19-/m1/s1 |
| InChIKey | LMAMRQMLLBCVRP-LJQANCHMSA-N |
| XLogP | 4.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |