C24H20Cl2N2O2 — CID 93322816
(3S)-4-(2,4-dichlorobenzoyl)-3-methyl-1-(2-phenylphenyl)piperazin-2-one (PubChem CID 93322816) has the molecular formula C24H20Cl2N2O2 and a molecular weight of 439.34 g/mol. Its IUPAC name is (3S)-4-(2,4-dichlorobenzoyl)-3-methyl-1-(2-phenylphenyl)piperazin-2-one.
| Compound Name | (3S)-4-(2,4-dichlorobenzoyl)-3-methyl-1-(2-phenylphenyl)piperazin-2-one |
|---|---|
| PubChem CID | 93322816 |
| Molecular Formula | C24H20Cl2N2O2 |
| Molecular Weight | 439.34 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | (3S)-4-(2,4-dichlorobenzoyl)-3-methyl-1-(2-phenylphenyl)piperazin-2-one |
| SMILES | C[C@H]1C(=O)N(c2ccccc2-c2ccccc2)CCN1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H20Cl2N2O2/c1-16-23(29)28(22-10-6-5-9-19(22)17-7-3-2-4-8-17)14-13-27(16)24(30)20-12-11-18(25)15-21(20)26/h2-12,15-16H,13-14H2,1H3/t16-/m0/s1 |
| InChIKey | HREQDRSAWRFSID-INIZCTEOSA-N |
| XLogP | 5.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.34 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |