C19H18Cl2N2O3 — CID 46036549
1-(2,4-dichlorophenyl)-4-(4-methoxybenzoyl)-3-methylpiperazin-2-one (PubChem CID 46036549) has the molecular formula C19H18Cl2N2O3 and a molecular weight of 393.27 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-4-(4-methoxybenzoyl)-3-methylpiperazin-2-one.
| Compound Name | 1-(2,4-dichlorophenyl)-4-(4-methoxybenzoyl)-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 46036549 |
| Molecular Formula | C19H18Cl2N2O3 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-4-(4-methoxybenzoyl)-3-methylpiperazin-2-one |
| SMILES | COc1ccc(C(=O)N2CCN(c3ccc(Cl)cc3Cl)C(=O)C2C)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O3/c1-12-18(24)23(17-8-5-14(20)11-16(17)21)10-9-22(12)19(25)13-3-6-15(26-2)7-4-13/h3-8,11-12H,9-10H2,1-2H3 |
| InChIKey | PYWGLAGAKRKVDF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |