C18H15Cl2N3O4 — CID 93322651
(3R)-1-(2,4-dichlorophenyl)-3-methyl-4-(4-nitrobenzoyl)piperazin-2-one (PubChem CID 93322651) has the molecular formula C18H15Cl2N3O4 and a molecular weight of 408.24 g/mol. Its IUPAC name is (3R)-1-(2,4-dichlorophenyl)-3-methyl-4-(4-nitrobenzoyl)piperazin-2-one.
| Compound Name | (3R)-1-(2,4-dichlorophenyl)-3-methyl-4-(4-nitrobenzoyl)piperazin-2-one |
|---|---|
| PubChem CID | 93322651 |
| Molecular Formula | C18H15Cl2N3O4 |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | (3R)-1-(2,4-dichlorophenyl)-3-methyl-4-(4-nitrobenzoyl)piperazin-2-one |
| SMILES | C[C@@H]1C(=O)N(c2ccc(Cl)cc2Cl)CCN1C(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15Cl2N3O4/c1-11-17(24)22(16-7-4-13(19)10-15(16)20)9-8-21(11)18(25)12-2-5-14(6-3-12)23(26)27/h2-7,10-11H,8-9H2,1H3/t11-/m1/s1 |
| InChIKey | UIHUFMJSYRSYDI-LLVKDONJSA-N |
| XLogP | 3.78 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|